| Name | 2,3,4-trifluorocinnamic acid |
| Synonyms | 2,3,4-Trifluorocinna 2,3,4-trifluorocinnamic acid 2,3,4-Trifluorocinnamic acid 2 3 4-TRIFLUOROCINNAMIC ACID 99 3-(2,3,4-Trifluorophenyl)acrylic acid 2-Propenoic acid, 3-(2,3,4-trifluorophenyl)- (2E)-3-(2,3,4-trifluorophenyl)prop-2-enoic acid 3-(2,3,4-Trifluorophenyl)acrylic acid, 3-(2,3,4-Trifluorophenyl)prop-2-enoic acid |
| CAS | 207742-85-6 |
| InChI | InChI=1/C9H5F3O2/c10-6-3-1-5(2-4-7(13)14)8(11)9(6)12/h1-4H,(H,13,14)/b4-2+ |
| Molecular Formula | C9H5F3O2 |
| Molar Mass | 202.13 |
| Density | 1.468±0.06 g/cm3(Predicted) |
| Melting Point | 175-178°C(lit.) |
| Boling Point | 273.8±35.0 °C(Predicted) |
| Flash Point | 119.4°C |
| Vapor Presure | 0.00273mmHg at 25°C |
| pKa | 4.13±0.15(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.547 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| Hazard Class | IRRITANT |